About 2-methyloctan-3-yl 4-hydroxyoctanoate
2-methyloctan-3-yl 4-hydroxyoctanoate (PubChem CID 87363154) has the molecular formula C17H34O3
and a molecular weight of 286.46 g/mol. Its IUPAC name is 2-methyloctan-3-yl 4-hydroxyoctanoate.
Molecular Properties
| Compound Name | 2-methyloctan-3-yl 4-hydroxyoctanoate |
| PubChem CID | 87363154 |
| Molecular Formula | C17H34O3 |
| Molecular Weight | 286.46 g/mol |
| Exact Mass | 286.25 |
| IUPAC Name | 2-methyloctan-3-yl 4-hydroxyoctanoate |
| SMILES | CCCCCC(OC(=O)CCC(O)CCCC)C(C)C |
| InChI | InChI=1S/C17H34O3/c1-5-7-9-11-16(14(3)4)20-17(19)13-12-15(18)10-8-6-2/h14-16,18H,5-13H2,1-4H3 |
| InChIKey | XTCRCSAAWANNCW-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 286.46 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-methyloctan-3-yl 4-hydroxyoctanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyloctan-3-yl 4-hydroxyoctanoate?
The IUPAC name of 2-methyloctan-3-yl 4-hydroxyoctanoate (CID 87363154) is 2-methyloctan-3-yl 4-hydroxyoctanoate.
What is the SMILES notation for 2-methyloctan-3-yl 4-hydroxyoctanoate?
The canonical SMILES for 2-methyloctan-3-yl 4-hydroxyoctanoate is CCCCCC(OC(=O)CCC(O)CCCC)C(C)C.
What is the InChIKey of 2-methyloctan-3-yl 4-hydroxyoctanoate?
The InChIKey is XTCRCSAAWANNCW-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H34O3/c1-5-7-9-11-16(14(3)4)20-17(19)13-12-15(18)10-8-6-2/h14-16,18H,5-13H2,1-4H3.
What are the key properties of 2-methyloctan-3-yl 4-hydroxyoctanoate?
2-methyloctan-3-yl 4-hydroxyoctanoate has a molecular weight of 286.46 g/mol, XLogP of 4.47, 12 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyloctan-3-yl 4-hydroxyoctanoate is sourced from PubChem (CID 87363154), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).