C19H31ClN2O2 — CID 24994467
1-(dibutylamino)butan-2-yl 4-amino-2-chlorobenzoate (PubChem CID 24994467) has the molecular formula C19H31ClN2O2 and a molecular weight of 354.92 g/mol. Its IUPAC name is 1-(dibutylamino)butan-2-yl 4-amino-2-chlorobenzoate.
| Compound Name | 1-(dibutylamino)butan-2-yl 4-amino-2-chlorobenzoate |
|---|---|
| PubChem CID | 24994467 |
| Molecular Formula | C19H31ClN2O2 |
| Molecular Weight | 354.92 g/mol |
| Exact Mass | 354.21 |
| IUPAC Name | 1-(dibutylamino)butan-2-yl 4-amino-2-chlorobenzoate |
| SMILES | CCCCN(CCCC)CC(CC)OC(=O)c1ccc(N)cc1Cl |
| InChI | InChI=1S/C19H31ClN2O2/c1-4-7-11-22(12-8-5-2)14-16(6-3)24-19(23)17-10-9-15(21)13-18(17)20/h9-10,13,16H,4-8,11-12,14,21H2,1-3H3 |
| InChIKey | SWPRRVSTKFQDFR-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.92 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|