C15H18Cl2O4 — CID 69124377
4,5-dichloro-2-(2,2-dimethylpentan-3-yloxycarbonyl)benzoic acid (PubChem CID 69124377) has the molecular formula C15H18Cl2O4 and a molecular weight of 333.21 g/mol. Its IUPAC name is 4,5-dichloro-2-(2,2-dimethylpentan-3-yloxycarbonyl)benzoic acid.
| Compound Name | 4,5-dichloro-2-(2,2-dimethylpentan-3-yloxycarbonyl)benzoic acid |
|---|---|
| PubChem CID | 69124377 |
| Molecular Formula | C15H18Cl2O4 |
| Molecular Weight | 333.21 g/mol |
| Exact Mass | 332.06 |
| IUPAC Name | 4,5-dichloro-2-(2,2-dimethylpentan-3-yloxycarbonyl)benzoic acid |
| SMILES | CCC(OC(=O)c1cc(Cl)c(Cl)cc1C(=O)O)C(C)(C)C |
| InChI | InChI=1S/C15H18Cl2O4/c1-5-12(15(2,3)4)21-14(20)9-7-11(17)10(16)6-8(9)13(18)19/h6-7,12H,5H2,1-4H3,(H,18,19) |
| InChIKey | OQTLXUMRWLDHEQ-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.21 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |