C17H23FO4 — CID 69125012
2-(2,2-dimethylheptan-3-yloxycarbonyl)-6-fluorobenzoic acid (PubChem CID 69125012) has the molecular formula C17H23FO4 and a molecular weight of 310.37 g/mol. Its IUPAC name is 2-(2,2-dimethylheptan-3-yloxycarbonyl)-6-fluorobenzoic acid.
| Compound Name | 2-(2,2-dimethylheptan-3-yloxycarbonyl)-6-fluorobenzoic acid |
|---|---|
| PubChem CID | 69125012 |
| Molecular Formula | C17H23FO4 |
| Molecular Weight | 310.37 g/mol |
| Exact Mass | 310.16 |
| IUPAC Name | 2-(2,2-dimethylheptan-3-yloxycarbonyl)-6-fluorobenzoic acid |
| SMILES | CCCCC(OC(=O)c1cccc(F)c1C(=O)O)C(C)(C)C |
| InChI | InChI=1S/C17H23FO4/c1-5-6-10-13(17(2,3)4)22-16(21)11-8-7-9-12(18)14(11)15(19)20/h7-9,13H,5-6,10H2,1-4H3,(H,19,20) |
| InChIKey | OPNOXXMGKWLVCY-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.37 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |