C13H16ClFO3 — CID 175702140
3-(4-chloro-3-fluorophenoxy)-2,2-dimethylpentanoic acid (PubChem CID 175702140) has the molecular formula C13H16ClFO3 and a molecular weight of 274.72 g/mol. Its IUPAC name is 3-(4-chloro-3-fluorophenoxy)-2,2-dimethylpentanoic acid.
| Compound Name | 3-(4-chloro-3-fluorophenoxy)-2,2-dimethylpentanoic acid |
|---|---|
| PubChem CID | 175702140 |
| Molecular Formula | C13H16ClFO3 |
| Molecular Weight | 274.72 g/mol |
| Exact Mass | 274.08 |
| IUPAC Name | 3-(4-chloro-3-fluorophenoxy)-2,2-dimethylpentanoic acid |
| SMILES | CCC(Oc1ccc(Cl)c(F)c1)C(C)(C)C(=O)O |
| InChI | InChI=1S/C13H16ClFO3/c1-4-11(13(2,3)12(16)17)18-8-5-6-9(14)10(15)7-8/h5-7,11H,4H2,1-3H3,(H,16,17) |
| InChIKey | ZYXDMSLIZVRHPL-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.72 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |