About 4-bromo-5-ethylphthalic acid
4-bromo-5-ethylphthalic acid (PubChem CID 91027917) has the molecular formula C10H9BrO4
and a molecular weight of 273.08 g/mol. Its IUPAC name is 4-bromo-5-ethylphthalic acid.
Molecular Properties
| Compound Name | 4-bromo-5-ethylphthalic acid |
| PubChem CID | 91027917 |
| Molecular Formula | C10H9BrO4 |
| Molecular Weight | 273.08 g/mol |
| Exact Mass | 271.97 |
| IUPAC Name | 4-bromo-5-ethylphthalic acid |
| SMILES | CCc1cc(C(=O)O)c(C(=O)O)cc1Br |
| InChI | InChI=1S/C10H9BrO4/c1-2-5-3-6(9(12)13)7(10(14)15)4-8(5)11/h3-4H,2H2,1H3,(H,12,13)(H,14,15) |
| InChIKey | LICQVPZOIPYNPD-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 273.08 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-bromo-5-ethylphthalic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-bromo-5-ethylphthalic acid?
The IUPAC name of 4-bromo-5-ethylphthalic acid (CID 91027917) is 4-bromo-5-ethylphthalic acid.
What is the SMILES notation for 4-bromo-5-ethylphthalic acid?
The canonical SMILES for 4-bromo-5-ethylphthalic acid is CCc1cc(C(=O)O)c(C(=O)O)cc1Br.
What is the InChIKey of 4-bromo-5-ethylphthalic acid?
The InChIKey is LICQVPZOIPYNPD-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9BrO4/c1-2-5-3-6(9(12)13)7(10(14)15)4-8(5)11/h3-4H,2H2,1H3,(H,12,13)(H,14,15).
What are the key properties of 4-bromo-5-ethylphthalic acid?
4-bromo-5-ethylphthalic acid has a molecular weight of 273.08 g/mol, XLogP of 2.41, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-bromo-5-ethylphthalic acid is sourced from PubChem (CID 91027917), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).