C18H25BrO4 — CID 23502290
bis(2-methylpropyl) 4-bromo-5-ethylbenzene-1,2-dicarboxylate (PubChem CID 23502290) has the molecular formula C18H25BrO4 and a molecular weight of 385.30 g/mol. Its IUPAC name is bis(2-methylpropyl) 4-bromo-5-ethylbenzene-1,2-dicarboxylate.
| Compound Name | bis(2-methylpropyl) 4-bromo-5-ethylbenzene-1,2-dicarboxylate |
|---|---|
| PubChem CID | 23502290 |
| Molecular Formula | C18H25BrO4 |
| Molecular Weight | 385.30 g/mol |
| Exact Mass | 384.09 |
| IUPAC Name | bis(2-methylpropyl) 4-bromo-5-ethylbenzene-1,2-dicarboxylate |
| SMILES | CCc1cc(C(=O)OCC(C)C)c(C(=O)OCC(C)C)cc1Br |
| InChI | InChI=1S/C18H25BrO4/c1-6-13-7-14(17(20)22-9-11(2)3)15(8-16(13)19)18(21)23-10-12(4)5/h7-8,11-12H,6,9-10H2,1-5H3 |
| InChIKey | XVESOMSKMLFWMH-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.30 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |