About 2-O-ethyl 1-O-(2-methylpropyl) 4-chloro-5-methylbenzene-1,2-dicarboxylate
2-O-ethyl 1-O-(2-methylpropyl) 4-chloro-5-methylbenzene-1,2-dicarboxylate (PubChem CID 23502163) has the molecular formula C15H19ClO4
and a molecular weight of 298.77 g/mol. Its IUPAC name is 2-O-ethyl 1-O-(2-methylpropyl) 4-chloro-5-methylbenzene-1,2-dicarboxylate.
Analyze 2-O-ethyl 1-O-(2-methylpropyl) 4-chloro-5-methylbenzene-1,2-dicarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-O-ethyl 1-O-(2-methylpropyl) 4-chloro-5-methylbenzene-1,2-dicarboxylate?
The IUPAC name of 2-O-ethyl 1-O-(2-methylpropyl) 4-chloro-5-methylbenzene-1,2-dicarboxylate (CID 23502163) is 2-O-ethyl 1-O-(2-methylpropyl) 4-chloro-5-methylbenzene-1,2-dicarboxylate.
What is the SMILES notation for 2-O-ethyl 1-O-(2-methylpropyl) 4-chloro-5-methylbenzene-1,2-dicarboxylate?
The canonical SMILES for 2-O-ethyl 1-O-(2-methylpropyl) 4-chloro-5-methylbenzene-1,2-dicarboxylate is CCOC(=O)c1cc(Cl)c(C)cc1C(=O)OCC(C)C.
What is the InChIKey of 2-O-ethyl 1-O-(2-methylpropyl) 4-chloro-5-methylbenzene-1,2-dicarboxylate?
The InChIKey is ILPQQELXBDRHFH-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H19ClO4/c1-5-19-14(17)12-7-13(16)10(4)6-11(12)15(18)20-8-9(2)3/h6-7,9H,5,8H2,1-4H3.
What are the key properties of 2-O-ethyl 1-O-(2-methylpropyl) 4-chloro-5-methylbenzene-1,2-dicarboxylate?
2-O-ethyl 1-O-(2-methylpropyl) 4-chloro-5-methylbenzene-1,2-dicarboxylate has a molecular weight of 298.77 g/mol, XLogP of 3.64, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-O-ethyl 1-O-(2-methylpropyl) 4-chloro-5-methylbenzene-1,2-dicarboxylate is sourced from PubChem (CID 23502163), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).