C22H34O4 — CID 154394626
2-(5,5-diethyl-2-methylnonan-4-yl)oxycarbonylbenzoic acid (PubChem CID 154394626) has the molecular formula C22H34O4 and a molecular weight of 362.51 g/mol. Its IUPAC name is 2-(5,5-diethyl-2-methylnonan-4-yl)oxycarbonylbenzoic acid.
| Compound Name | 2-(5,5-diethyl-2-methylnonan-4-yl)oxycarbonylbenzoic acid |
|---|---|
| PubChem CID | 154394626 |
| Molecular Formula | C22H34O4 |
| Molecular Weight | 362.51 g/mol |
| Exact Mass | 362.25 |
| IUPAC Name | 2-(5,5-diethyl-2-methylnonan-4-yl)oxycarbonylbenzoic acid |
| SMILES | CCCCC(CC)(CC)C(CC(C)C)OC(=O)c1ccccc1C(=O)O |
| InChI | InChI=1S/C22H34O4/c1-6-9-14-22(7-2,8-3)19(15-16(4)5)26-21(25)18-13-11-10-12-17(18)20(23)24/h10-13,16,19H,6-9,14-15H2,1-5H3,(H,23,24) |
| InChIKey | AZQYQIRDBAFCBB-UHFFFAOYSA-N |
| XLogP | 5.95 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.51 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |