C12H20ClNO4S — CID 23319887
2-(chloromethyl)-2-methylpropane-1,3-diol;4-methylbenzenesulfonamide (PubChem CID 23319887) has the molecular formula C12H20ClNO4S and a molecular weight of 309.81 g/mol. Its IUPAC name is 2-(chloromethyl)-2-methylpropane-1,3-diol;4-methylbenzenesulfonamide.
| Compound Name | 2-(chloromethyl)-2-methylpropane-1,3-diol;4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 23319887 |
| Molecular Formula | C12H20ClNO4S |
| Molecular Weight | 309.81 g/mol |
| Exact Mass | 309.08 |
| IUPAC Name | 2-(chloromethyl)-2-methylpropane-1,3-diol;4-methylbenzenesulfonamide |
| SMILES | CC(CO)(CO)CCl.Cc1ccc(S(N)(=O)=O)cc1 |
| InChI | InChI=1S/C7H9NO2S.C5H11ClO2/c1-6-2-4-7(5-3-6)11(8,9)10;1-5(2-6,3-7)4-8/h2-5H,1H3,(H2,8,9,10);7-8H,2-4H2,1H3 |
| InChIKey | CRQFNHYBIABHGZ-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 100.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.81 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|