C10H15N3O3S — CID 146610620
[amino-[4-(2-hydroxypropan-2-yl)phenyl]-oxo-λ6-sulfanylidene]urea (PubChem CID 146610620) has the molecular formula C10H15N3O3S and a molecular weight of 257.32 g/mol. Its IUPAC name is [amino-[4-(2-hydroxypropan-2-yl)phenyl]-oxo-λ6-sulfanylidene]urea.
| Compound Name | [amino-[4-(2-hydroxypropan-2-yl)phenyl]-oxo-λ6-sulfanylidene]urea |
|---|---|
| PubChem CID | 146610620 |
| Molecular Formula | C10H15N3O3S |
| Molecular Weight | 257.32 g/mol |
| Exact Mass | 257.08 |
| IUPAC Name | [amino-[4-(2-hydroxypropan-2-yl)phenyl]-oxo-λ6-sulfanylidene]urea |
| SMILES | CC(C)(O)c1ccc(S(N)(=O)=NC(N)=O)cc1 |
| InChI | InChI=1S/C10H15N3O3S/c1-10(2,15)7-3-5-8(6-4-7)17(12,16)13-9(11)14/h3-6,15H,1-2H3,(H4,11,12,13,14,16) |
| InChIKey | VEDZYKWPQIGBHV-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 118.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.32 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |