About [amino-[4-(2-hydroxypropan-2-yl)phenyl]-oxo-λ6-sulfanylidene]urea
[amino-[4-(2-hydroxypropan-2-yl)phenyl]-oxo-λ6-sulfanylidene]urea (PubChem CID 146610620) has the molecular formula C10H15N3O3S
and a molecular weight of 257.32 g/mol. Its IUPAC name is [amino-[4-(2-hydroxypropan-2-yl)phenyl]-oxo-λ6-sulfanylidene]urea.
Molecular Properties
| Compound Name | [amino-[4-(2-hydroxypropan-2-yl)phenyl]-oxo-λ6-sulfanylidene]urea |
| PubChem CID | 146610620 |
| Molecular Formula | C10H15N3O3S |
| Molecular Weight | 257.32 g/mol |
| Exact Mass | 257.08 |
| IUPAC Name | [amino-[4-(2-hydroxypropan-2-yl)phenyl]-oxo-λ6-sulfanylidene]urea |
| SMILES | CC(C)(O)c1ccc(S(N)(=O)=NC(N)=O)cc1 |
| InChI | InChI=1S/C10H15N3O3S/c1-10(2,15)7-3-5-8(6-4-7)17(12,16)13-9(11)14/h3-6,15H,1-2H3,(H4,11,12,13,14,16) |
| InChIKey | VEDZYKWPQIGBHV-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 118.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 257.32 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [amino-[4-(2-hydroxypropan-2-yl)phenyl]-oxo-λ6-sulfanylidene]urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [amino-[4-(2-hydroxypropan-2-yl)phenyl]-oxo-λ6-sulfanylidene]urea?
The IUPAC name of [amino-[4-(2-hydroxypropan-2-yl)phenyl]-oxo-λ6-sulfanylidene]urea (CID 146610620) is [amino-[4-(2-hydroxypropan-2-yl)phenyl]-oxo-λ6-sulfanylidene]urea.
What is the SMILES notation for [amino-[4-(2-hydroxypropan-2-yl)phenyl]-oxo-λ6-sulfanylidene]urea?
The canonical SMILES for [amino-[4-(2-hydroxypropan-2-yl)phenyl]-oxo-λ6-sulfanylidene]urea is CC(C)(O)c1ccc(S(N)(=O)=NC(N)=O)cc1.
What is the InChIKey of [amino-[4-(2-hydroxypropan-2-yl)phenyl]-oxo-λ6-sulfanylidene]urea?
The InChIKey is VEDZYKWPQIGBHV-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15N3O3S/c1-10(2,15)7-3-5-8(6-4-7)17(12,16)13-9(11)14/h3-6,15H,1-2H3,(H4,11,12,13,14,16).
What are the key properties of [amino-[4-(2-hydroxypropan-2-yl)phenyl]-oxo-λ6-sulfanylidene]urea?
[amino-[4-(2-hydroxypropan-2-yl)phenyl]-oxo-λ6-sulfanylidene]urea has a molecular weight of 257.32 g/mol, XLogP of 0.69, 2 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [amino-[4-(2-hydroxypropan-2-yl)phenyl]-oxo-λ6-sulfanylidene]urea is sourced from PubChem (CID 146610620), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).