C15H12N2O4S — CID 59587869
CID 59587869 (PubChem CID 59587869) has the molecular formula C15H12N2O4S and a molecular weight of 316.34 g/mol.
| Compound Name | CID 59587869 |
|---|---|
| PubChem CID | 59587869 |
| Molecular Formula | C15H12N2O4S |
| Molecular Weight | 316.34 g/mol |
| Exact Mass | 316.05 |
| IUPAC Name | — |
| SMILES | [CH]C(=O)c1ccccc1C(=O)Nc1ccc(S(N)(=O)=O)cc1 |
| InChI | InChI=1S/C15H12N2O4S/c1-10(18)13-4-2-3-5-14(13)15(19)17-11-6-8-12(9-7-11)22(16,20)21/h1-9H,(H,17,19)(H2,16,20,21) |
| InChIKey | SPHRKJOLPHOIKI-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 106.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.34 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |