C15H11Cl3N2OS — CID 17133786
3,5-dichloro-N-[(3-chloro-4-methylphenyl)carbamothioyl]benzamide (PubChem CID 17133786) has the molecular formula C15H11Cl3N2OS and a molecular weight of 373.69 g/mol. Its IUPAC name is 3,5-dichloro-N-[(3-chloro-4-methylphenyl)carbamothioyl]benzamide.
| Compound Name | 3,5-dichloro-N-[(3-chloro-4-methylphenyl)carbamothioyl]benzamide |
|---|---|
| PubChem CID | 17133786 |
| Molecular Formula | C15H11Cl3N2OS |
| Molecular Weight | 373.69 g/mol |
| Exact Mass | 371.97 |
| IUPAC Name | 3,5-dichloro-N-[(3-chloro-4-methylphenyl)carbamothioyl]benzamide |
| SMILES | Cc1ccc(NC(=S)NC(=O)c2cc(Cl)cc(Cl)c2)cc1Cl |
| InChI | InChI=1S/C15H11Cl3N2OS/c1-8-2-3-12(7-13(8)18)19-15(22)20-14(21)9-4-10(16)6-11(17)5-9/h2-7H,1H3,(H2,19,20,21,22) |
| InChIKey | UGCYXWXHCAJVAQ-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.69 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|