C16H14Cl2N2OS — CID 2278928
N-[(3,5-dichlorophenyl)carbamothioyl]-3,4-dimethylbenzamide (PubChem CID 2278928) has the molecular formula C16H14Cl2N2OS and a molecular weight of 353.27 g/mol. Its IUPAC name is N-[(3,5-dichlorophenyl)carbamothioyl]-3,4-dimethylbenzamide.
| Compound Name | N-[(3,5-dichlorophenyl)carbamothioyl]-3,4-dimethylbenzamide |
|---|---|
| PubChem CID | 2278928 |
| Molecular Formula | C16H14Cl2N2OS |
| Molecular Weight | 353.27 g/mol |
| Exact Mass | 352.02 |
| IUPAC Name | N-[(3,5-dichlorophenyl)carbamothioyl]-3,4-dimethylbenzamide |
| SMILES | Cc1ccc(C(=O)NC(=S)Nc2cc(Cl)cc(Cl)c2)cc1C |
| InChI | InChI=1S/C16H14Cl2N2OS/c1-9-3-4-11(5-10(9)2)15(21)20-16(22)19-14-7-12(17)6-13(18)8-14/h3-8H,1-2H3,(H2,19,20,21,22) |
| InChIKey | LELHKZGVSQQFMS-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.27 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|