C21H24Cl2N4O2S — CID 87280785
3,5-dichloro-N-[[4-[5-(dimethylamino)pentanoylamino]phenyl]carbamothioyl]benzamide (PubChem CID 87280785) has the molecular formula C21H24Cl2N4O2S and a molecular weight of 467.42 g/mol. Its IUPAC name is 3,5-dichloro-N-[[4-[5-(dimethylamino)pentanoylamino]phenyl]carbamothioyl]benzamide.
| Compound Name | 3,5-dichloro-N-[[4-[5-(dimethylamino)pentanoylamino]phenyl]carbamothioyl]benzamide |
|---|---|
| PubChem CID | 87280785 |
| Molecular Formula | C21H24Cl2N4O2S |
| Molecular Weight | 467.42 g/mol |
| Exact Mass | 466.10 |
| IUPAC Name | 3,5-dichloro-N-[[4-[5-(dimethylamino)pentanoylamino]phenyl]carbamothioyl]benzamide |
| SMILES | CN(C)CCCCC(=O)Nc1ccc(NC(=S)NC(=O)c2cc(Cl)cc(Cl)c2)cc1 |
| InChI | InChI=1S/C21H24Cl2N4O2S/c1-27(2)10-4-3-5-19(28)24-17-6-8-18(9-7-17)25-21(30)26-20(29)14-11-15(22)13-16(23)12-14/h6-9,11-13H,3-5,10H2,1-2H3,(H,24,28)(H2,25,26,29,30) |
| InChIKey | GUXFDSURXRXQFP-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 73.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.42 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|