C23H31ClN4O2S — CID 87280606
N-[[4-[5-(dimethylamino)pentanoylamino]phenyl]carbamothioyl]-4-ethylbenzamide;hydrochloride (PubChem CID 87280606) has the molecular formula C23H31ClN4O2S and a molecular weight of 463.05 g/mol. Its IUPAC name is N-[[4-[5-(dimethylamino)pentanoylamino]phenyl]carbamothioyl]-4-ethylbenzamide;hydrochloride.
| Compound Name | N-[[4-[5-(dimethylamino)pentanoylamino]phenyl]carbamothioyl]-4-ethylbenzamide;hydrochloride |
|---|---|
| PubChem CID | 87280606 |
| Molecular Formula | C23H31ClN4O2S |
| Molecular Weight | 463.05 g/mol |
| Exact Mass | 462.19 |
| IUPAC Name | N-[[4-[5-(dimethylamino)pentanoylamino]phenyl]carbamothioyl]-4-ethylbenzamide;hydrochloride |
| SMILES | CCc1ccc(C(=O)NC(=S)Nc2ccc(NC(=O)CCCCN(C)C)cc2)cc1.Cl |
| InChI | InChI=1S/C23H30N4O2S.ClH/c1-4-17-8-10-18(11-9-17)22(29)26-23(30)25-20-14-12-19(13-15-20)24-21(28)7-5-6-16-27(2)3;/h8-15H,4-7,16H2,1-3H3,(H,24,28)(H2,25,26,29,30);1H |
| InChIKey | YMBCRFHWRUCINY-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 73.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.05 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|