C23H29Cl2N3O2S — CID 158882816
3-chloro-N-[[4-[6-(dimethylamino)-2-oxohexyl]phenyl]carbamothioyl]-4-methylbenzamide;hydrochloride (PubChem CID 158882816) has the molecular formula C23H29Cl2N3O2S and a molecular weight of 482.48 g/mol. Its IUPAC name is 3-chloro-N-[[4-[6-(dimethylamino)-2-oxohexyl]phenyl]carbamothioyl]-4-methylbenzamide;hydrochloride.
| Compound Name | 3-chloro-N-[[4-[6-(dimethylamino)-2-oxohexyl]phenyl]carbamothioyl]-4-methylbenzamide;hydrochloride |
|---|---|
| PubChem CID | 158882816 |
| Molecular Formula | C23H29Cl2N3O2S |
| Molecular Weight | 482.48 g/mol |
| Exact Mass | 481.14 |
| IUPAC Name | 3-chloro-N-[[4-[6-(dimethylamino)-2-oxohexyl]phenyl]carbamothioyl]-4-methylbenzamide;hydrochloride |
| SMILES | Cc1ccc(C(=O)NC(=S)Nc2ccc(CC(=O)CCCCN(C)C)cc2)cc1Cl.Cl |
| InChI | InChI=1S/C23H28ClN3O2S.ClH/c1-16-7-10-18(15-21(16)24)22(29)26-23(30)25-19-11-8-17(9-12-19)14-20(28)6-4-5-13-27(2)3;/h7-12,15H,4-6,13-14H2,1-3H3,(H2,25,26,29,30);1H |
| InChIKey | BJTCMXSTAVDLEA-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.48 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|