C10H10Cl3N3S — CID 3251978
1-prop-2-enyl-3-(2,4,6-trichloroanilino)thiourea (PubChem CID 3251978) has the molecular formula C10H10Cl3N3S and a molecular weight of 310.64 g/mol. Its IUPAC name is 1-prop-2-enyl-3-(2,4,6-trichloroanilino)thiourea.
| Compound Name | 1-prop-2-enyl-3-(2,4,6-trichloroanilino)thiourea |
|---|---|
| PubChem CID | 3251978 |
| Molecular Formula | C10H10Cl3N3S |
| Molecular Weight | 310.64 g/mol |
| Exact Mass | 308.97 |
| IUPAC Name | 1-prop-2-enyl-3-(2,4,6-trichloroanilino)thiourea |
| SMILES | C=CCNC(=S)NNc1c(Cl)cc(Cl)cc1Cl |
| InChI | InChI=1S/C10H10Cl3N3S/c1-2-3-14-10(17)16-15-9-7(12)4-6(11)5-8(9)13/h2,4-5,15H,1,3H2,(H2,14,16,17) |
| InChIKey | PVUJKNYGCXPZLZ-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 36.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.64 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|