C14H16Cl3N3S — CID 50904760
1-[(1S,2R,4R)-2-bicyclo[2.2.1]heptanyl]-3-(2,4,6-trichloroanilino)thiourea (PubChem CID 50904760) has the molecular formula C14H16Cl3N3S and a molecular weight of 364.73 g/mol. Its IUPAC name is 1-[(1S,2R,4R)-2-bicyclo[2.2.1]heptanyl]-3-(2,4,6-trichloroanilino)thiourea.
| Compound Name | 1-[(1S,2R,4R)-2-bicyclo[2.2.1]heptanyl]-3-(2,4,6-trichloroanilino)thiourea |
|---|---|
| PubChem CID | 50904760 |
| Molecular Formula | C14H16Cl3N3S |
| Molecular Weight | 364.73 g/mol |
| Exact Mass | 363.01 |
| IUPAC Name | 1-[(1S,2R,4R)-2-bicyclo[2.2.1]heptanyl]-3-(2,4,6-trichloroanilino)thiourea |
| SMILES | S=C(NNc1c(Cl)cc(Cl)cc1Cl)N[C@@H]1C[C@@H]2CC[C@H]1C2 |
| InChI | InChI=1S/C14H16Cl3N3S/c15-9-5-10(16)13(11(17)6-9)19-20-14(21)18-12-4-7-1-2-8(12)3-7/h5-8,12,19H,1-4H2,(H2,18,20,21)/t7-,8+,12-/m1/s1 |
| InChIKey | KIBKVQNSQGHGMX-RGNHYFCHSA-N |
| XLogP | 4.63 |
| TPSA | 36.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.73 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|