C12H14Cl3N3OS — CID 3986728
1-(oxolan-2-ylmethyl)-3-(2,4,6-trichloroanilino)thiourea (PubChem CID 3986728) has the molecular formula C12H14Cl3N3OS and a molecular weight of 354.69 g/mol. Its IUPAC name is 1-(oxolan-2-ylmethyl)-3-(2,4,6-trichloroanilino)thiourea.
| Compound Name | 1-(oxolan-2-ylmethyl)-3-(2,4,6-trichloroanilino)thiourea |
|---|---|
| PubChem CID | 3986728 |
| Molecular Formula | C12H14Cl3N3OS |
| Molecular Weight | 354.69 g/mol |
| Exact Mass | 352.99 |
| IUPAC Name | 1-(oxolan-2-ylmethyl)-3-(2,4,6-trichloroanilino)thiourea |
| SMILES | S=C(NCC1CCCO1)NNc1c(Cl)cc(Cl)cc1Cl |
| InChI | InChI=1S/C12H14Cl3N3OS/c13-7-4-9(14)11(10(15)5-7)17-18-12(20)16-6-8-2-1-3-19-8/h4-5,8,17H,1-3,6H2,(H2,16,18,20) |
| InChIKey | BMYWWESLNJDNCA-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 45.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.69 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|