C19H18BrN3O6S — CID 31541890
4-bromo-3-[[(2,5-dimethylfuran-3-carbonyl)amino]carbamoyl]-N-(furan-2-ylmethyl)benzenesulfonamide (PubChem CID 31541890) has the molecular formula C19H18BrN3O6S and a molecular weight of 496.34 g/mol. Its IUPAC name is 4-bromo-3-[[(2,5-dimethylfuran-3-carbonyl)amino]carbamoyl]-N-(furan-2-ylmethyl)benzenesulfonamide.
| Compound Name | 4-bromo-3-[[(2,5-dimethylfuran-3-carbonyl)amino]carbamoyl]-N-(furan-2-ylmethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 31541890 |
| Molecular Formula | C19H18BrN3O6S |
| Molecular Weight | 496.34 g/mol |
| Exact Mass | 495.01 |
| IUPAC Name | 4-bromo-3-[[(2,5-dimethylfuran-3-carbonyl)amino]carbamoyl]-N-(furan-2-ylmethyl)benzenesulfonamide |
| SMILES | Cc1cc(C(=O)NNC(=O)c2cc(S(=O)(=O)NCc3ccco3)ccc2Br)c(C)o1 |
| InChI | InChI=1S/C19H18BrN3O6S/c1-11-8-15(12(2)29-11)18(24)22-23-19(25)16-9-14(5-6-17(16)20)30(26,27)21-10-13-4-3-7-28-13/h3-9,21H,10H2,1-2H3,(H,22,24)(H,23,25) |
| InChIKey | AUTLMNRREBXLKT-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 130.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.34 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|