C21H25FN2O5S — CID 43004196
methyl 6-[[5-[(4-fluorophenyl)sulfamoyl]-2-methylbenzoyl]amino]hexanoate (PubChem CID 43004196) has the molecular formula C21H25FN2O5S and a molecular weight of 436.51 g/mol. Its IUPAC name is methyl 6-[[5-[(4-fluorophenyl)sulfamoyl]-2-methylbenzoyl]amino]hexanoate.
| Compound Name | methyl 6-[[5-[(4-fluorophenyl)sulfamoyl]-2-methylbenzoyl]amino]hexanoate |
|---|---|
| PubChem CID | 43004196 |
| Molecular Formula | C21H25FN2O5S |
| Molecular Weight | 436.51 g/mol |
| Exact Mass | 436.15 |
| IUPAC Name | methyl 6-[[5-[(4-fluorophenyl)sulfamoyl]-2-methylbenzoyl]amino]hexanoate |
| SMILES | COC(=O)CCCCCNC(=O)c1cc(S(=O)(=O)Nc2ccc(F)cc2)ccc1C |
| InChI | InChI=1S/C21H25FN2O5S/c1-15-7-12-18(30(27,28)24-17-10-8-16(22)9-11-17)14-19(15)21(26)23-13-5-3-4-6-20(25)29-2/h7-12,14,24H,3-6,13H2,1-2H3,(H,23,26) |
| InChIKey | NIJQAVQAMZYNTQ-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 101.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.51 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|