C22H21FN4O4S — CID 55845123
N-[2-(2-cyano-3-fluoroanilino)ethyl]-5-(furan-2-ylmethylsulfamoyl)-2-methylbenzamide (PubChem CID 55845123) has the molecular formula C22H21FN4O4S and a molecular weight of 456.50 g/mol. Its IUPAC name is N-[2-(2-cyano-3-fluoroanilino)ethyl]-5-(furan-2-ylmethylsulfamoyl)-2-methylbenzamide.
| Compound Name | N-[2-(2-cyano-3-fluoroanilino)ethyl]-5-(furan-2-ylmethylsulfamoyl)-2-methylbenzamide |
|---|---|
| PubChem CID | 55845123 |
| Molecular Formula | C22H21FN4O4S |
| Molecular Weight | 456.50 g/mol |
| Exact Mass | 456.13 |
| IUPAC Name | N-[2-(2-cyano-3-fluoroanilino)ethyl]-5-(furan-2-ylmethylsulfamoyl)-2-methylbenzamide |
| SMILES | Cc1ccc(S(=O)(=O)NCc2ccco2)cc1C(=O)NCCNc1cccc(F)c1C#N |
| InChI | InChI=1S/C22H21FN4O4S/c1-15-7-8-17(32(29,30)27-14-16-4-3-11-31-16)12-18(15)22(28)26-10-9-25-21-6-2-5-20(23)19(21)13-24/h2-8,11-12,25,27H,9-10,14H2,1H3,(H,26,28) |
| InChIKey | BFLGEBMQGABOEU-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 124.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.50 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|