C23H21BrN2O3S — CID 17353316
5-bromo-2-ethoxy-N-[(4-phenylmethoxyphenyl)carbamothioyl]benzamide (PubChem CID 17353316) has the molecular formula C23H21BrN2O3S and a molecular weight of 485.40 g/mol. Its IUPAC name is 5-bromo-2-ethoxy-N-[(4-phenylmethoxyphenyl)carbamothioyl]benzamide.
| Compound Name | 5-bromo-2-ethoxy-N-[(4-phenylmethoxyphenyl)carbamothioyl]benzamide |
|---|---|
| PubChem CID | 17353316 |
| Molecular Formula | C23H21BrN2O3S |
| Molecular Weight | 485.40 g/mol |
| Exact Mass | 484.05 |
| IUPAC Name | 5-bromo-2-ethoxy-N-[(4-phenylmethoxyphenyl)carbamothioyl]benzamide |
| SMILES | CCOc1ccc(Br)cc1C(=O)NC(=S)Nc1ccc(OCc2ccccc2)cc1 |
| InChI | InChI=1S/C23H21BrN2O3S/c1-2-28-21-13-8-17(24)14-20(21)22(27)26-23(30)25-18-9-11-19(12-10-18)29-15-16-6-4-3-5-7-16/h3-14H,2,15H2,1H3,(H2,25,26,27,30) |
| InChIKey | LBWZRUUIINYLEL-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.40 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|