C24H32N2O4S — CID 17149762
3-butan-2-yloxy-N-[4-[cyclohexyl(methyl)sulfamoyl]phenyl]benzamide (PubChem CID 17149762) has the molecular formula C24H32N2O4S and a molecular weight of 444.60 g/mol. Its IUPAC name is 3-butan-2-yloxy-N-[4-[cyclohexyl(methyl)sulfamoyl]phenyl]benzamide.
| Compound Name | 3-butan-2-yloxy-N-[4-[cyclohexyl(methyl)sulfamoyl]phenyl]benzamide |
|---|---|
| PubChem CID | 17149762 |
| Molecular Formula | C24H32N2O4S |
| Molecular Weight | 444.60 g/mol |
| Exact Mass | 444.21 |
| IUPAC Name | 3-butan-2-yloxy-N-[4-[cyclohexyl(methyl)sulfamoyl]phenyl]benzamide |
| SMILES | CCC(C)Oc1cccc(C(=O)Nc2ccc(S(=O)(=O)N(C)C3CCCCC3)cc2)c1 |
| InChI | InChI=1S/C24H32N2O4S/c1-4-18(2)30-22-12-8-9-19(17-22)24(27)25-20-13-15-23(16-14-20)31(28,29)26(3)21-10-6-5-7-11-21/h8-9,12-18,21H,4-7,10-11H2,1-3H3,(H,25,27) |
| InChIKey | MQEYTVQTBPLCCG-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.60 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |