C19H22BrClN2O4 — CID 71082222
5-bromo-3-butoxy-N-[(3-chlorophenyl)methyl]-1-(2-hydroxyethyl)-4-oxopyridine-2-carboxamide (PubChem CID 71082222) has the molecular formula C19H22BrClN2O4 and a molecular weight of 457.75 g/mol. Its IUPAC name is 5-bromo-3-butoxy-N-[(3-chlorophenyl)methyl]-1-(2-hydroxyethyl)-4-oxopyridine-2-carboxamide.
| Compound Name | 5-bromo-3-butoxy-N-[(3-chlorophenyl)methyl]-1-(2-hydroxyethyl)-4-oxopyridine-2-carboxamide |
|---|---|
| PubChem CID | 71082222 |
| Molecular Formula | C19H22BrClN2O4 |
| Molecular Weight | 457.75 g/mol |
| Exact Mass | 456.05 |
| IUPAC Name | 5-bromo-3-butoxy-N-[(3-chlorophenyl)methyl]-1-(2-hydroxyethyl)-4-oxopyridine-2-carboxamide |
| SMILES | CCCCOc1c(C(=O)NCc2cccc(Cl)c2)n(CCO)cc(Br)c1=O |
| InChI | InChI=1S/C19H22BrClN2O4/c1-2-3-9-27-18-16(23(7-8-24)12-15(20)17(18)25)19(26)22-11-13-5-4-6-14(21)10-13/h4-6,10,12,24H,2-3,7-9,11H2,1H3,(H,22,26) |
| InChIKey | DAVRMLASYMDPDA-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 80.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.75 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|