C20H21NO7 — CID 129129880
diethyl 4-oxo-1-(2-oxoethyl)-3-phenylmethoxypyridine-2,5-dicarboxylate (PubChem CID 129129880) has the molecular formula C20H21NO7 and a molecular weight of 387.39 g/mol. Its IUPAC name is diethyl 4-oxo-1-(2-oxoethyl)-3-phenylmethoxypyridine-2,5-dicarboxylate.
| Compound Name | diethyl 4-oxo-1-(2-oxoethyl)-3-phenylmethoxypyridine-2,5-dicarboxylate |
|---|---|
| PubChem CID | 129129880 |
| Molecular Formula | C20H21NO7 |
| Molecular Weight | 387.39 g/mol |
| Exact Mass | 387.13 |
| IUPAC Name | diethyl 4-oxo-1-(2-oxoethyl)-3-phenylmethoxypyridine-2,5-dicarboxylate |
| SMILES | CCOC(=O)c1cn(CC=O)c(C(=O)OCC)c(OCc2ccccc2)c1=O |
| InChI | InChI=1S/C20H21NO7/c1-3-26-19(24)15-12-21(10-11-22)16(20(25)27-4-2)18(17(15)23)28-13-14-8-6-5-7-9-14/h5-9,11-12H,3-4,10,13H2,1-2H3 |
| InChIKey | GVDLYOKWEOCIEF-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 100.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.39 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|