C25H22FNO6 — CID 157330935
methyl 5-[3-(4-fluorophenyl)propanoyl]-4-oxo-1-(2-oxoethyl)-3-phenylmethoxypyridine-2-carboxylate (PubChem CID 157330935) has the molecular formula C25H22FNO6 and a molecular weight of 451.45 g/mol. Its IUPAC name is methyl 5-[3-(4-fluorophenyl)propanoyl]-4-oxo-1-(2-oxoethyl)-3-phenylmethoxypyridine-2-carboxylate.
| Compound Name | methyl 5-[3-(4-fluorophenyl)propanoyl]-4-oxo-1-(2-oxoethyl)-3-phenylmethoxypyridine-2-carboxylate |
|---|---|
| PubChem CID | 157330935 |
| Molecular Formula | C25H22FNO6 |
| Molecular Weight | 451.45 g/mol |
| Exact Mass | 451.14 |
| IUPAC Name | methyl 5-[3-(4-fluorophenyl)propanoyl]-4-oxo-1-(2-oxoethyl)-3-phenylmethoxypyridine-2-carboxylate |
| SMILES | COC(=O)c1c(OCc2ccccc2)c(=O)c(C(=O)CCc2ccc(F)cc2)cn1CC=O |
| InChI | InChI=1S/C25H22FNO6/c1-32-25(31)22-24(33-16-18-5-3-2-4-6-18)23(30)20(15-27(22)13-14-28)21(29)12-9-17-7-10-19(26)11-8-17/h2-8,10-11,14-15H,9,12-13,16H2,1H3 |
| InChIKey | IDKVADXACMWBBK-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 91.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.45 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|