C18H16FNO6 — CID 160555107
methyl 5-[3-(4-fluorophenyl)propanoyl]-3-hydroxy-4-oxo-1-(2-oxoethyl)pyridine-2-carboxylate (PubChem CID 160555107) has the molecular formula C18H16FNO6 and a molecular weight of 361.33 g/mol. Its IUPAC name is methyl 5-[3-(4-fluorophenyl)propanoyl]-3-hydroxy-4-oxo-1-(2-oxoethyl)pyridine-2-carboxylate.
| Compound Name | methyl 5-[3-(4-fluorophenyl)propanoyl]-3-hydroxy-4-oxo-1-(2-oxoethyl)pyridine-2-carboxylate |
|---|---|
| PubChem CID | 160555107 |
| Molecular Formula | C18H16FNO6 |
| Molecular Weight | 361.33 g/mol |
| Exact Mass | 361.10 |
| IUPAC Name | methyl 5-[3-(4-fluorophenyl)propanoyl]-3-hydroxy-4-oxo-1-(2-oxoethyl)pyridine-2-carboxylate |
| SMILES | COC(=O)c1c(O)c(=O)c(C(=O)CCc2ccc(F)cc2)cn1CC=O |
| InChI | InChI=1S/C18H16FNO6/c1-26-18(25)15-17(24)16(23)13(10-20(15)8-9-21)14(22)7-4-11-2-5-12(19)6-3-11/h2-3,5-6,9-10,24H,4,7-8H2,1H3 |
| InChIKey | ZMHWXBMHAVAKLR-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 102.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.33 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|