C18H16F2NO6P — CID 147215224
methyl 5-[3-(2,4-difluorophenyl)propanoyl]-4-oxo-1-(2-oxoethyl)-3-phosphanyloxypyridine-2-carboxylate (PubChem CID 147215224) has the molecular formula C18H16F2NO6P and a molecular weight of 411.30 g/mol. Its IUPAC name is methyl 5-[3-(2,4-difluorophenyl)propanoyl]-4-oxo-1-(2-oxoethyl)-3-phosphanyloxypyridine-2-carboxylate.
| Compound Name | methyl 5-[3-(2,4-difluorophenyl)propanoyl]-4-oxo-1-(2-oxoethyl)-3-phosphanyloxypyridine-2-carboxylate |
|---|---|
| PubChem CID | 147215224 |
| Molecular Formula | C18H16F2NO6P |
| Molecular Weight | 411.30 g/mol |
| Exact Mass | 411.07 |
| IUPAC Name | methyl 5-[3-(2,4-difluorophenyl)propanoyl]-4-oxo-1-(2-oxoethyl)-3-phosphanyloxypyridine-2-carboxylate |
| SMILES | COC(=O)c1c(OP)c(=O)c(C(=O)CCc2ccc(F)cc2F)cn1CC=O |
| InChI | InChI=1S/C18H16F2NO6P/c1-26-18(25)15-17(27-28)16(24)12(9-21(15)6-7-22)14(23)5-3-10-2-4-11(19)8-13(10)20/h2,4,7-9H,3,5-6,28H2,1H3 |
| InChIKey | CFZFPRWLGPITKI-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 91.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.30 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|