C32H28N2O5 — CID 130410671
methyl 1,8-dioxo-9-phenylmethoxy-4-(2-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,11,13-hexaenyl)-3,4-dihydro-2H-pyrido[1,2-a]pyrazine-7-carboxylate (PubChem CID 130410671) has the molecular formula C32H28N2O5 and a molecular weight of 520.59 g/mol. Its IUPAC name is methyl 1,8-dioxo-9-phenylmethoxy-4-(2-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,11,13-hexaenyl)-3,4-dihydro-2H-pyrido[1,2-a]pyrazine-7-carboxylate.
| Compound Name | methyl 1,8-dioxo-9-phenylmethoxy-4-(2-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,11,13-hexaenyl)-3,4-dihydro-2H-pyrido[1,2-a]pyrazine-7-carboxylate |
|---|---|
| PubChem CID | 130410671 |
| Molecular Formula | C32H28N2O5 |
| Molecular Weight | 520.59 g/mol |
| Exact Mass | 520.20 |
| IUPAC Name | methyl 1,8-dioxo-9-phenylmethoxy-4-(2-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,11,13-hexaenyl)-3,4-dihydro-2H-pyrido[1,2-a]pyrazine-7-carboxylate |
| SMILES | COC(=O)c1cn2c(c(OCc3ccccc3)c1=O)C(=O)NCC2C1c2ccccc2CCc2ccccc21 |
| InChI | InChI=1S/C32H28N2O5/c1-38-32(37)25-18-34-26(27-23-13-7-5-11-21(23)15-16-22-12-6-8-14-24(22)27)17-33-31(36)28(34)30(29(25)35)39-19-20-9-3-2-4-10-20/h2-14,18,26-27H,15-17,19H2,1H3,(H,33,36) |
| InChIKey | QDZOZWCJKVJBJR-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.59 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |