C36H27N3O8S2 — CID 45103267
dimethyl 3,4-bis[1-(benzenesulfonyl)indol-3-yl]-1H-pyrrole-2,5-dicarboxylate (PubChem CID 45103267) has the molecular formula C36H27N3O8S2 and a molecular weight of 693.76 g/mol. Its IUPAC name is dimethyl 3,4-bis[1-(benzenesulfonyl)indol-3-yl]-1H-pyrrole-2,5-dicarboxylate.
| Compound Name | dimethyl 3,4-bis[1-(benzenesulfonyl)indol-3-yl]-1H-pyrrole-2,5-dicarboxylate |
|---|---|
| PubChem CID | 45103267 |
| Molecular Formula | C36H27N3O8S2 |
| Molecular Weight | 693.76 g/mol |
| Exact Mass | 693.12 |
| IUPAC Name | dimethyl 3,4-bis[1-(benzenesulfonyl)indol-3-yl]-1H-pyrrole-2,5-dicarboxylate |
| SMILES | COC(=O)c1[nH]c(C(=O)OC)c(-c2cn(S(=O)(=O)c3ccccc3)c3ccccc23)c1-c1cn(S(=O)(=O)c2ccccc2)c2ccccc12 |
| InChI | InChI=1S/C36H27N3O8S2/c1-46-35(40)33-31(27-21-38(29-19-11-9-17-25(27)29)48(42,43)23-13-5-3-6-14-23)32(34(37-33)36(41)47-2)28-22-39(30-20-12-10-18-26(28)30)49(44,45)24-15-7-4-8-16-24/h3-22,37H,1-2H3 |
| InChIKey | YTHKWVFTDJULNL-UHFFFAOYSA-N |
| XLogP | 6.31 |
| TPSA | 146.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 693.76 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |