C6H4Br3NO2 — CID 13152807
methyl 3,4,5-tribromo-1H-pyrrole-2-carboxylate (PubChem CID 13152807) has the molecular formula C6H4Br3NO2 and a molecular weight of 361.82 g/mol. Its IUPAC name is methyl 3,4,5-tribromo-1H-pyrrole-2-carboxylate.
| Compound Name | methyl 3,4,5-tribromo-1H-pyrrole-2-carboxylate |
|---|---|
| PubChem CID | 13152807 |
| Molecular Formula | C6H4Br3NO2 |
| Molecular Weight | 361.82 g/mol |
| Exact Mass | 358.78 |
| IUPAC Name | methyl 3,4,5-tribromo-1H-pyrrole-2-carboxylate |
| SMILES | COC(=O)c1[nH]c(Br)c(Br)c1Br |
| InChI | InChI=1S/C6H4Br3NO2/c1-12-6(11)4-2(7)3(8)5(9)10-4/h10H,1H3 |
| InChIKey | JKARVVJCKXGAHO-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 42.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.82 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |