C6H9N3O2 — CID 70096824
methyl 4-(aminomethyl)-1H-pyrazole-5-carboxylate (PubChem CID 70096824) has the molecular formula C6H9N3O2 and a molecular weight of 155.16 g/mol. Its IUPAC name is methyl 4-(aminomethyl)-1H-pyrazole-5-carboxylate.
| Compound Name | methyl 4-(aminomethyl)-1H-pyrazole-5-carboxylate |
|---|---|
| PubChem CID | 70096824 |
| Molecular Formula | C6H9N3O2 |
| Molecular Weight | 155.16 g/mol |
| Exact Mass | 155.07 |
| IUPAC Name | methyl 4-(aminomethyl)-1H-pyrazole-5-carboxylate |
| SMILES | COC(=O)c1[nH]ncc1CN |
| InChI | InChI=1S/C6H9N3O2/c1-11-6(10)5-4(2-7)3-8-9-5/h3H,2,7H2,1H3,(H,8,9) |
| InChIKey | MVHKGWAHLAQGEJ-UHFFFAOYSA-N |
| XLogP | -0.34 |
| TPSA | 81.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 155.16 |
| LogP ≤ 5 | -0.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |