C8H8N2O3 — CID 169484983
methyl 4-(3-hydroxyprop-1-ynyl)-1H-pyrazole-5-carboxylate (PubChem CID 169484983) has the molecular formula C8H8N2O3 and a molecular weight of 180.16 g/mol. Its IUPAC name is methyl 4-(3-hydroxyprop-1-ynyl)-1H-pyrazole-5-carboxylate.
| Compound Name | methyl 4-(3-hydroxyprop-1-ynyl)-1H-pyrazole-5-carboxylate |
|---|---|
| PubChem CID | 169484983 |
| Molecular Formula | C8H8N2O3 |
| Molecular Weight | 180.16 g/mol |
| Exact Mass | 180.05 |
| IUPAC Name | methyl 4-(3-hydroxyprop-1-ynyl)-1H-pyrazole-5-carboxylate |
| SMILES | COC(=O)c1[nH]ncc1C#CCO |
| InChI | InChI=1S/C8H8N2O3/c1-13-8(12)7-6(3-2-4-11)5-9-10-7/h5,11H,4H2,1H3,(H,9,10) |
| InChIKey | XHCGNTVQPKRTLS-UHFFFAOYSA-N |
| XLogP | -0.46 |
| TPSA | 75.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.16 |
| LogP ≤ 5 | -0.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|