C20H18N2O4 — CID 86006540
methyl 3-(1H-indol-2-yl)-5,6-dimethoxy-1H-indole-2-carboxylate (PubChem CID 86006540) has the molecular formula C20H18N2O4 and a molecular weight of 350.37 g/mol. Its IUPAC name is methyl 3-(1H-indol-2-yl)-5,6-dimethoxy-1H-indole-2-carboxylate.
| Compound Name | methyl 3-(1H-indol-2-yl)-5,6-dimethoxy-1H-indole-2-carboxylate |
|---|---|
| PubChem CID | 86006540 |
| Molecular Formula | C20H18N2O4 |
| Molecular Weight | 350.37 g/mol |
| Exact Mass | 350.13 |
| IUPAC Name | methyl 3-(1H-indol-2-yl)-5,6-dimethoxy-1H-indole-2-carboxylate |
| SMILES | COC(=O)c1[nH]c2cc(OC)c(OC)cc2c1-c1cc2ccccc2[nH]1 |
| InChI | InChI=1S/C20H18N2O4/c1-24-16-9-12-14(10-17(16)25-2)22-19(20(23)26-3)18(12)15-8-11-6-4-5-7-13(11)21-15/h4-10,21-22H,1-3H3 |
| InChIKey | TWAAMNZUZJJAQE-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 76.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.37 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |