C16H10N2O2 — CID 70335444
2-amino-6H-indeno[1,2-c]isoquinoline-5,11-dione (PubChem CID 70335444) has the molecular formula C16H10N2O2 and a molecular weight of 262.27 g/mol. Its IUPAC name is 2-amino-6H-indeno[1,2-c]isoquinoline-5,11-dione.
| Compound Name | 2-amino-6H-indeno[1,2-c]isoquinoline-5,11-dione |
|---|---|
| PubChem CID | 70335444 |
| Molecular Formula | C16H10N2O2 |
| Molecular Weight | 262.27 g/mol |
| Exact Mass | 262.07 |
| IUPAC Name | 2-amino-6H-indeno[1,2-c]isoquinoline-5,11-dione |
| SMILES | Nc1ccc2c(=O)[nH]c3c(c2c1)C(=O)c1ccccc1-3 |
| InChI | InChI=1S/C16H10N2O2/c17-8-5-6-11-12(7-8)13-14(18-16(11)20)9-3-1-2-4-10(9)15(13)19/h1-7H,17H2,(H,18,20) |
| InChIKey | PVWNRPXIYHSSAL-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 75.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.27 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'keto_phenone_A(11)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|