About bis(1H-azepine);9H-carbazole
bis(1H-azepine);9H-carbazole (PubChem CID 174976693) has the molecular formula C24H23N3
and a molecular weight of 353.47 g/mol. Its IUPAC name is bis(1H-azepine);9H-carbazole.
Molecular Properties
| Compound Name | bis(1H-azepine);9H-carbazole |
| PubChem CID | 174976693 |
| Molecular Formula | C24H23N3 |
| Molecular Weight | 353.47 g/mol |
| Exact Mass | 353.19 |
| IUPAC Name | bis(1H-azepine);9H-carbazole |
| SMILES | C1=CC=CNC=C1.C1=CC=CNC=C1.c1ccc2c(c1)[nH]c1ccccc12 |
| InChI | InChI=1S/C12H9N.2C6H7N/c1-3-7-11-9(5-1)10-6-2-4-8-12(10)13-11;2*1-2-4-6-7-5-3-1/h1-8,13H;2*1-7H |
| InChIKey | HOOSATYADANXBT-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 39.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 353.47 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze bis(1H-azepine);9H-carbazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(1H-azepine);9H-carbazole?
The IUPAC name of bis(1H-azepine);9H-carbazole (CID 174976693) is bis(1H-azepine);9H-carbazole.
What is the SMILES notation for bis(1H-azepine);9H-carbazole?
The canonical SMILES for bis(1H-azepine);9H-carbazole is C1=CC=CNC=C1.C1=CC=CNC=C1.c1ccc2c(c1)[nH]c1ccccc12.
What is the InChIKey of bis(1H-azepine);9H-carbazole?
The InChIKey is HOOSATYADANXBT-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H9N.2C6H7N/c1-3-7-11-9(5-1)10-6-2-4-8-12(10)13-11;2*1-2-4-6-7-5-3-1/h1-8,13H;2*1-7H.
What are the key properties of bis(1H-azepine);9H-carbazole?
bis(1H-azepine);9H-carbazole has a molecular weight of 353.47 g/mol, XLogP of 5.67, 0 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for bis(1H-azepine);9H-carbazole is sourced from PubChem (CID 174976693), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).