C16H8N2O2S — CID 11022687
3-thia-9,19-diazapentacyclo[10.7.0.02,6.07,11.013,18]nonadeca-1,4,6,11,13,15,17-heptaene-8,10-dione (PubChem CID 11022687) has the molecular formula C16H8N2O2S and a molecular weight of 292.32 g/mol. Its IUPAC name is 3-thia-9,19-diazapentacyclo[10.7.0.02,6.07,11.013,18]nonadeca-1,4,6,11,13,15,17-heptaene-8,10-dione.
| Compound Name | 3-thia-9,19-diazapentacyclo[10.7.0.02,6.07,11.013,18]nonadeca-1,4,6,11,13,15,17-heptaene-8,10-dione |
|---|---|
| PubChem CID | 11022687 |
| Molecular Formula | C16H8N2O2S |
| Molecular Weight | 292.32 g/mol |
| Exact Mass | 292.03 |
| IUPAC Name | 3-thia-9,19-diazapentacyclo[10.7.0.02,6.07,11.013,18]nonadeca-1,4,6,11,13,15,17-heptaene-8,10-dione |
| SMILES | O=C1NC(=O)c2c1c1ccsc1c1[nH]c3ccccc3c21 |
| InChI | InChI=1S/C16H8N2O2S/c19-15-11-8-5-6-21-14(8)13-10(12(11)16(20)18-15)7-3-1-2-4-9(7)17-13/h1-6,17H,(H,18,19,20) |
| InChIKey | UYMLBTOZRBAURE-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 61.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.32 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|