C22H14N2O2 — CID 67550909
23-methyl-3,13-diazahexacyclo[14.7.0.02,10.04,9.011,15.017,22]tricosa-1,4,6,8,10,15,17,19,21-nonaene-12,14-dione (PubChem CID 67550909) has the molecular formula C22H14N2O2 and a molecular weight of 338.37 g/mol. Its IUPAC name is 23-methyl-3,13-diazahexacyclo[14.7.0.02,10.04,9.011,15.017,22]tricosa-1,4,6,8,10,15,17,19,21-nonaene-12,14-dione.
| Compound Name | 23-methyl-3,13-diazahexacyclo[14.7.0.02,10.04,9.011,15.017,22]tricosa-1,4,6,8,10,15,17,19,21-nonaene-12,14-dione |
|---|---|
| PubChem CID | 67550909 |
| Molecular Formula | C22H14N2O2 |
| Molecular Weight | 338.37 g/mol |
| Exact Mass | 338.11 |
| IUPAC Name | 23-methyl-3,13-diazahexacyclo[14.7.0.02,10.04,9.011,15.017,22]tricosa-1,4,6,8,10,15,17,19,21-nonaene-12,14-dione |
| SMILES | CC1c2ccccc2-c2c3c(c4c([nH]c5ccccc54)c21)C(=O)NC3=O |
| InChI | InChI=1S/C22H14N2O2/c1-10-11-6-2-3-7-12(11)16-15(10)20-17(13-8-4-5-9-14(13)23-20)19-18(16)21(25)24-22(19)26/h2-10,23H,1H3,(H,24,25,26) |
| InChIKey | KBKRUKWKRCSOPG-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 61.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.37 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|