C19H12N2O3 — CID 11067046
17-methoxy-4,14-diazapentacyclo[11.7.0.02,6.07,12.015,20]icosa-1(13),2(6),7,9,11,15(20),16,18-octaene-3,5-dione (PubChem CID 11067046) has the molecular formula C19H12N2O3 and a molecular weight of 316.32 g/mol. Its IUPAC name is 17-methoxy-4,14-diazapentacyclo[11.7.0.02,6.07,12.015,20]icosa-1(13),2(6),7,9,11,15(20),16,18-octaene-3,5-dione.
| Compound Name | 17-methoxy-4,14-diazapentacyclo[11.7.0.02,6.07,12.015,20]icosa-1(13),2(6),7,9,11,15(20),16,18-octaene-3,5-dione |
|---|---|
| PubChem CID | 11067046 |
| Molecular Formula | C19H12N2O3 |
| Molecular Weight | 316.32 g/mol |
| Exact Mass | 316.08 |
| IUPAC Name | 17-methoxy-4,14-diazapentacyclo[11.7.0.02,6.07,12.015,20]icosa-1(13),2(6),7,9,11,15(20),16,18-octaene-3,5-dione |
| SMILES | COc1ccc2c(c1)[nH]c1c3ccccc3c3c(c21)C(=O)NC3=O |
| InChI | InChI=1S/C19H12N2O3/c1-24-9-6-7-12-13(8-9)20-17-11-5-3-2-4-10(11)15-16(14(12)17)19(23)21-18(15)22/h2-8,20H,1H3,(H,21,22,23) |
| InChIKey | JEGDVGAVJOERBJ-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 71.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.32 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|