C15H10N2O3 — CID 11843684
9-methoxy-6H-pyrrolo[3,4-c]carbazole-1,3-dione (PubChem CID 11843684) has the molecular formula C15H10N2O3 and a molecular weight of 266.26 g/mol. Its IUPAC name is 9-methoxy-6H-pyrrolo[3,4-c]carbazole-1,3-dione.
| Compound Name | 9-methoxy-6H-pyrrolo[3,4-c]carbazole-1,3-dione |
|---|---|
| PubChem CID | 11843684 |
| Molecular Formula | C15H10N2O3 |
| Molecular Weight | 266.26 g/mol |
| Exact Mass | 266.07 |
| IUPAC Name | 9-methoxy-6H-pyrrolo[3,4-c]carbazole-1,3-dione |
| SMILES | COc1ccc2[nH]c3ccc4c(c3c2c1)C(=O)NC4=O |
| InChI | InChI=1S/C15H10N2O3/c1-20-7-2-4-10-9(6-7)12-11(16-10)5-3-8-13(12)15(19)17-14(8)18/h2-6,16H,1H3,(H,17,18,19) |
| InChIKey | JDYAUMBHBMIRSC-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 71.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.26 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|