C22H15N3O6 — CID 91289981
9-methoxy-4-(2-methoxy-5-nitrophenyl)-6H-pyrrolo[3,4-c]carbazole-1,3-dione (PubChem CID 91289981) has the molecular formula C22H15N3O6 and a molecular weight of 417.38 g/mol. Its IUPAC name is 9-methoxy-4-(2-methoxy-5-nitrophenyl)-6H-pyrrolo[3,4-c]carbazole-1,3-dione.
| Compound Name | 9-methoxy-4-(2-methoxy-5-nitrophenyl)-6H-pyrrolo[3,4-c]carbazole-1,3-dione |
|---|---|
| PubChem CID | 91289981 |
| Molecular Formula | C22H15N3O6 |
| Molecular Weight | 417.38 g/mol |
| Exact Mass | 417.10 |
| IUPAC Name | 9-methoxy-4-(2-methoxy-5-nitrophenyl)-6H-pyrrolo[3,4-c]carbazole-1,3-dione |
| SMILES | COc1ccc2[nH]c3cc(-c4cc([N+](=O)[O-])ccc4OC)c4c(c3c2c1)C(=O)NC4=O |
| InChI | InChI=1S/C22H15N3O6/c1-30-11-4-5-15-14(8-11)18-16(23-15)9-13(19-20(18)22(27)24-21(19)26)12-7-10(25(28)29)3-6-17(12)31-2/h3-9,23H,1-2H3,(H,24,26,27) |
| InChIKey | JPMZSTOWMISRKO-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 123.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.38 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|