C21H13N3O7 — CID 14699120
4-(5-methoxy-2-nitrophenyl)-7-(2-nitrophenyl)isoindole-1,3-dione (PubChem CID 14699120) has the molecular formula C21H13N3O7 and a molecular weight of 419.35 g/mol. Its IUPAC name is 4-(5-methoxy-2-nitrophenyl)-7-(2-nitrophenyl)isoindole-1,3-dione.
| Compound Name | 4-(5-methoxy-2-nitrophenyl)-7-(2-nitrophenyl)isoindole-1,3-dione |
|---|---|
| PubChem CID | 14699120 |
| Molecular Formula | C21H13N3O7 |
| Molecular Weight | 419.35 g/mol |
| Exact Mass | 419.08 |
| IUPAC Name | 4-(5-methoxy-2-nitrophenyl)-7-(2-nitrophenyl)isoindole-1,3-dione |
| SMILES | COc1ccc([N+](=O)[O-])c(-c2ccc(-c3ccccc3[N+](=O)[O-])c3c2C(=O)NC3=O)c1 |
| InChI | InChI=1S/C21H13N3O7/c1-31-11-6-9-17(24(29)30)15(10-11)14-8-7-13(18-19(14)21(26)22-20(18)25)12-4-2-3-5-16(12)23(27)28/h2-10H,1H3,(H,22,25,26) |
| InChIKey | RGOLYXUCSZWXJD-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 141.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.35 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|