C11H13N3O3S — CID 57409458
5-(5-methoxy-2-nitrophenyl)-2,2-dimethyl-3H-1,3,4-thiadiazole (PubChem CID 57409458) has the molecular formula C11H13N3O3S and a molecular weight of 267.31 g/mol. Its IUPAC name is 5-(5-methoxy-2-nitrophenyl)-2,2-dimethyl-3H-1,3,4-thiadiazole.
| Compound Name | 5-(5-methoxy-2-nitrophenyl)-2,2-dimethyl-3H-1,3,4-thiadiazole |
|---|---|
| PubChem CID | 57409458 |
| Molecular Formula | C11H13N3O3S |
| Molecular Weight | 267.31 g/mol |
| Exact Mass | 267.07 |
| IUPAC Name | 5-(5-methoxy-2-nitrophenyl)-2,2-dimethyl-3H-1,3,4-thiadiazole |
| SMILES | COc1ccc([N+](=O)[O-])c(C2=NNC(C)(C)S2)c1 |
| InChI | InChI=1S/C11H13N3O3S/c1-11(2)13-12-10(18-11)8-6-7(17-3)4-5-9(8)14(15)16/h4-6,13H,1-3H3 |
| InChIKey | MCXMBRNGPWVRNS-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 76.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.31 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|