C18H10S2 — CID 147364120
4,8-dithiapentacyclo[10.8.0.02,9.03,7.014,19]icosa-1(20),2(9),3(7),5,10,12,14,16,18-nonaene (PubChem CID 147364120) has the molecular formula C18H10S2 and a molecular weight of 290.41 g/mol. Its IUPAC name is 4,8-dithiapentacyclo[10.8.0.02,9.03,7.014,19]icosa-1(20),2(9),3(7),5,10,12,14,16,18-nonaene.
| Compound Name | 4,8-dithiapentacyclo[10.8.0.02,9.03,7.014,19]icosa-1(20),2(9),3(7),5,10,12,14,16,18-nonaene |
|---|---|
| PubChem CID | 147364120 |
| Molecular Formula | C18H10S2 |
| Molecular Weight | 290.41 g/mol |
| Exact Mass | 290.02 |
| IUPAC Name | 4,8-dithiapentacyclo[10.8.0.02,9.03,7.014,19]icosa-1(20),2(9),3(7),5,10,12,14,16,18-nonaene |
| SMILES | c1ccc2cc3c(ccc4sc5ccsc5c43)cc2c1 |
| InChI | InChI=1S/C18H10S2/c1-2-4-12-10-14-13(9-11(12)3-1)5-6-15-17(14)18-16(20-15)7-8-19-18/h1-10H |
| InChIKey | DHVHACYGGNOOIB-UHFFFAOYSA-N |
| XLogP | 6.42 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.41 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|