C22H21Cl2N3O4 — CID 174321014
[2-[(2,3-dichlorophenyl)-(pyrimidin-2-ylamino)methyl]phenoxy]methyl propan-2-yl carbonate (PubChem CID 174321014) has the molecular formula C22H21Cl2N3O4 and a molecular weight of 462.33 g/mol. Its IUPAC name is [2-[(2,3-dichlorophenyl)-(pyrimidin-2-ylamino)methyl]phenoxy]methyl propan-2-yl carbonate.
| Compound Name | [2-[(2,3-dichlorophenyl)-(pyrimidin-2-ylamino)methyl]phenoxy]methyl propan-2-yl carbonate |
|---|---|
| PubChem CID | 174321014 |
| Molecular Formula | C22H21Cl2N3O4 |
| Molecular Weight | 462.33 g/mol |
| Exact Mass | 461.09 |
| IUPAC Name | [2-[(2,3-dichlorophenyl)-(pyrimidin-2-ylamino)methyl]phenoxy]methyl propan-2-yl carbonate |
| SMILES | CC(C)OC(=O)OCOc1ccccc1C(Nc1ncccn1)c1cccc(Cl)c1Cl |
| InChI | InChI=1S/C22H21Cl2N3O4/c1-14(2)31-22(28)30-13-29-18-10-4-3-7-15(18)20(27-21-25-11-6-12-26-21)16-8-5-9-17(23)19(16)24/h3-12,14,20H,13H2,1-2H3,(H,25,26,27) |
| InChIKey | ZFCGYRYJFQPMID-UHFFFAOYSA-N |
| XLogP | 5.88 |
| TPSA | 82.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.33 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|