C25H27N3O6 — CID 174319674
ethyl 4-[[2-(propan-2-yloxycarbonyloxymethoxy)phenyl]-(pyrimidin-2-ylamino)methyl]benzoate (PubChem CID 174319674) has the molecular formula C25H27N3O6 and a molecular weight of 465.51 g/mol. Its IUPAC name is ethyl 4-[[2-(propan-2-yloxycarbonyloxymethoxy)phenyl]-(pyrimidin-2-ylamino)methyl]benzoate.
| Compound Name | ethyl 4-[[2-(propan-2-yloxycarbonyloxymethoxy)phenyl]-(pyrimidin-2-ylamino)methyl]benzoate |
|---|---|
| PubChem CID | 174319674 |
| Molecular Formula | C25H27N3O6 |
| Molecular Weight | 465.51 g/mol |
| Exact Mass | 465.19 |
| IUPAC Name | ethyl 4-[[2-(propan-2-yloxycarbonyloxymethoxy)phenyl]-(pyrimidin-2-ylamino)methyl]benzoate |
| SMILES | CCOC(=O)c1ccc(C(Nc2ncccn2)c2ccccc2OCOC(=O)OC(C)C)cc1 |
| InChI | InChI=1S/C25H27N3O6/c1-4-31-23(29)19-12-10-18(11-13-19)22(28-24-26-14-7-15-27-24)20-8-5-6-9-21(20)32-16-33-25(30)34-17(2)3/h5-15,17,22H,4,16H2,1-3H3,(H,26,27,28) |
| InChIKey | ILXQCHSNVOQTJK-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 108.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.51 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|