C27H29NO5 — CID 175072041
ethyl 4-[(2R)-1-[bis(2-methoxyphenyl)methylamino]-1-oxopropan-2-yl]benzoate (PubChem CID 175072041) has the molecular formula C27H29NO5 and a molecular weight of 447.53 g/mol. Its IUPAC name is ethyl 4-[(2R)-1-[bis(2-methoxyphenyl)methylamino]-1-oxopropan-2-yl]benzoate.
| Compound Name | ethyl 4-[(2R)-1-[bis(2-methoxyphenyl)methylamino]-1-oxopropan-2-yl]benzoate |
|---|---|
| PubChem CID | 175072041 |
| Molecular Formula | C27H29NO5 |
| Molecular Weight | 447.53 g/mol |
| Exact Mass | 447.20 |
| IUPAC Name | ethyl 4-[(2R)-1-[bis(2-methoxyphenyl)methylamino]-1-oxopropan-2-yl]benzoate |
| SMILES | CCOC(=O)c1ccc([C@@H](C)C(=O)NC(c2ccccc2OC)c2ccccc2OC)cc1 |
| InChI | InChI=1S/C27H29NO5/c1-5-33-27(30)20-16-14-19(15-17-20)18(2)26(29)28-25(21-10-6-8-12-23(21)31-3)22-11-7-9-13-24(22)32-4/h6-18,25H,5H2,1-4H3,(H,28,29)/t18-/m1/s1 |
| InChIKey | TVPANTQCCFJFLV-GOSISDBHSA-N |
| XLogP | 4.89 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.53 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |