C24H24FNO3 — CID 175348426
N-[bis(2-methoxyphenyl)methyl]-2-(4-fluorophenyl)propanamide (PubChem CID 175348426) has the molecular formula C24H24FNO3 and a molecular weight of 393.46 g/mol. Its IUPAC name is N-[bis(2-methoxyphenyl)methyl]-2-(4-fluorophenyl)propanamide.
| Compound Name | N-[bis(2-methoxyphenyl)methyl]-2-(4-fluorophenyl)propanamide |
|---|---|
| PubChem CID | 175348426 |
| Molecular Formula | C24H24FNO3 |
| Molecular Weight | 393.46 g/mol |
| Exact Mass | 393.17 |
| IUPAC Name | N-[bis(2-methoxyphenyl)methyl]-2-(4-fluorophenyl)propanamide |
| SMILES | COc1ccccc1C(NC(=O)C(C)c1ccc(F)cc1)c1ccccc1OC |
| InChI | InChI=1S/C24H24FNO3/c1-16(17-12-14-18(25)15-13-17)24(27)26-23(19-8-4-6-10-21(19)28-2)20-9-5-7-11-22(20)29-3/h4-16,23H,1-3H3,(H,26,27) |
| InChIKey | CVKOLZRHIJKSAZ-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.46 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |